C29H40ClN3O4S — CID 90369240
N-[5-(1-methyl-2-oxoquinolin-6-yl)oxypentyl]-N-[1-(2-pyridin-3-ylethyl)cyclohexyl]methanesulfonamide;hydrochloride (PubChem CID 90369240) has the molecular formula C29H40ClN3O4S and a molecular weight of 562.18 g/mol. Its IUPAC name is N-[5-(1-methyl-2-oxoquinolin-6-yl)oxypentyl]-N-[1-(2-pyridin-3-ylethyl)cyclohexyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[5-(1-methyl-2-oxoquinolin-6-yl)oxypentyl]-N-[1-(2-pyridin-3-ylethyl)cyclohexyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 90369240 |
| Molecular Formula | C29H40ClN3O4S |
| Molecular Weight | 562.18 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | N-[5-(1-methyl-2-oxoquinolin-6-yl)oxypentyl]-N-[1-(2-pyridin-3-ylethyl)cyclohexyl]methanesulfonamide;hydrochloride |
| SMILES | Cl.Cn1c(=O)ccc2cc(OCCCCCN(C3(CCc4cccnc4)CCCCC3)S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C29H39N3O4S.ClH/c1-31-27-13-12-26(22-25(27)11-14-28(31)33)36-21-8-4-7-20-32(37(2,34)35)29(16-5-3-6-17-29)18-15-24-10-9-19-30-23-24;/h9-14,19,22-23H,3-8,15-18,20-21H2,1-2H3;1H |
| InChIKey | TWJKPBZUEYFMMS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.18 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|