C28H30N4O3 — CID 90229570
N-[5-(1-methyl-2-oxoquinolin-6-yl)oxypentyl]-N-(2-pyridin-3-ylethyl)pyridine-3-carboxamide (PubChem CID 90229570) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[5-(1-methyl-2-oxoquinolin-6-yl)oxypentyl]-N-(2-pyridin-3-ylethyl)pyridine-3-carboxamide.
| Compound Name | N-[5-(1-methyl-2-oxoquinolin-6-yl)oxypentyl]-N-(2-pyridin-3-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90229570 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-[5-(1-methyl-2-oxoquinolin-6-yl)oxypentyl]-N-(2-pyridin-3-ylethyl)pyridine-3-carboxamide |
| SMILES | Cn1c(=O)ccc2cc(OCCCCCN(CCc3cccnc3)C(=O)c3cccnc3)ccc21 |
| InChI | InChI=1S/C28H30N4O3/c1-31-26-11-10-25(19-23(26)9-12-27(31)33)35-18-4-2-3-16-32(17-13-22-7-5-14-29-20-22)28(34)24-8-6-15-30-21-24/h5-12,14-15,19-21H,2-4,13,16-18H2,1H3 |
| InChIKey | IPNYBCYVMQGXJA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|