C30H26O5 — CID 66963467
2-[1-[1,1-bis(2-hydroxyphenyl)prop-2-enoxy]-1-(2-hydroxyphenyl)prop-2-enyl]phenol (PubChem CID 66963467) has the molecular formula C30H26O5 and a molecular weight of 466.53 g/mol. Its IUPAC name is 2-[1-[1,1-bis(2-hydroxyphenyl)prop-2-enoxy]-1-(2-hydroxyphenyl)prop-2-enyl]phenol.
| Compound Name | 2-[1-[1,1-bis(2-hydroxyphenyl)prop-2-enoxy]-1-(2-hydroxyphenyl)prop-2-enyl]phenol |
|---|---|
| PubChem CID | 66963467 |
| Molecular Formula | C30H26O5 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-[1-[1,1-bis(2-hydroxyphenyl)prop-2-enoxy]-1-(2-hydroxyphenyl)prop-2-enyl]phenol |
| SMILES | C=CC(OC(C=C)(c1ccccc1O)c1ccccc1O)(c1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C30H26O5/c1-3-29(21-13-5-9-17-25(21)31,22-14-6-10-18-26(22)32)35-30(4-2,23-15-7-11-19-27(23)33)24-16-8-12-20-28(24)34/h3-20,31-34H,1-2H2 |
| InChIKey | VOBDMNVNUDKUDP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|