C12H15ClN2O3 — CID 66967731
3-(2,2-dimethyl-3,4-dihydropyrido[3,2-b][1,4]oxazin-7-yl)prop-2-enoic acid;hydrochloride (PubChem CID 66967731) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 3-(2,2-dimethyl-3,4-dihydropyrido[3,2-b][1,4]oxazin-7-yl)prop-2-enoic acid;hydrochloride.
| Compound Name | 3-(2,2-dimethyl-3,4-dihydropyrido[3,2-b][1,4]oxazin-7-yl)prop-2-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 66967731 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 3-(2,2-dimethyl-3,4-dihydropyrido[3,2-b][1,4]oxazin-7-yl)prop-2-enoic acid;hydrochloride |
| SMILES | CC1(C)CNc2ncc(C=CC(=O)O)cc2O1.Cl |
| InChI | InChI=1S/C12H14N2O3.ClH/c1-12(2)7-14-11-9(17-12)5-8(6-13-11)3-4-10(15)16;/h3-6H,7H2,1-2H3,(H,13,14)(H,15,16);1H |
| InChIKey | WOMYWKHCMIGCFO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|