C11H12N2O3 — CID 59332879
(E)-3-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepin-8-yl)prop-2-enoic acid (PubChem CID 59332879) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is (E)-3-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepin-8-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepin-8-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 59332879 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (E)-3-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepin-8-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc2c(c1)OCCCN2 |
| InChI | InChI=1S/C11H12N2O3/c14-10(15)3-2-8-6-9-11(13-7-8)12-4-1-5-16-9/h2-3,6-7H,1,4-5H2,(H,12,13)(H,14,15)/b3-2+ |
| InChIKey | PNVBJLSSGORHKJ-NSCUHMNNSA-N |
| XLogP | 1.37 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|