C11H12Cl4O2 — CID 66968737
2,3,5,6-tetrachloro-5-pentylcyclohex-2-ene-1,4-dione (PubChem CID 66968737) has the molecular formula C11H12Cl4O2 and a molecular weight of 318.03 g/mol. Its IUPAC name is 2,3,5,6-tetrachloro-5-pentylcyclohex-2-ene-1,4-dione.
| Compound Name | 2,3,5,6-tetrachloro-5-pentylcyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 66968737 |
| Molecular Formula | C11H12Cl4O2 |
| Molecular Weight | 318.03 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 2,3,5,6-tetrachloro-5-pentylcyclohex-2-ene-1,4-dione |
| SMILES | CCCCCC1(Cl)C(=O)C(Cl)=C(Cl)C(=O)C1Cl |
| InChI | InChI=1S/C11H12Cl4O2/c1-2-3-4-5-11(15)9(14)8(16)6(12)7(13)10(11)17/h9H,2-5H2,1H3 |
| InChIKey | RIDZUFWYLXQLRY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.03 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|