C22H22ClN3O6S — CID 66974338
methyl 3-[(5-chloro-7-nitro-1H-indole-2-carbonyl)amino]-4-[(4-methoxyphenyl)methylsulfanyl]butanoate (PubChem CID 66974338) has the molecular formula C22H22ClN3O6S and a molecular weight of 491.95 g/mol. Its IUPAC name is methyl 3-[(5-chloro-7-nitro-1H-indole-2-carbonyl)amino]-4-[(4-methoxyphenyl)methylsulfanyl]butanoate.
| Compound Name | methyl 3-[(5-chloro-7-nitro-1H-indole-2-carbonyl)amino]-4-[(4-methoxyphenyl)methylsulfanyl]butanoate |
|---|---|
| PubChem CID | 66974338 |
| Molecular Formula | C22H22ClN3O6S |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | methyl 3-[(5-chloro-7-nitro-1H-indole-2-carbonyl)amino]-4-[(4-methoxyphenyl)methylsulfanyl]butanoate |
| SMILES | COC(=O)CC(CSCc1ccc(OC)cc1)NC(=O)c1cc2cc(Cl)cc([N+](=O)[O-])c2[nH]1 |
| InChI | InChI=1S/C22H22ClN3O6S/c1-31-17-5-3-13(4-6-17)11-33-12-16(10-20(27)32-2)24-22(28)18-8-14-7-15(23)9-19(26(29)30)21(14)25-18/h3-9,16,25H,10-12H2,1-2H3,(H,24,28) |
| InChIKey | SLBPQEIOHNQCBH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|