C18H23Cl2NO3 — CID 66974993
(6R,7S)-2-tert-butyl-6-(3,4-dichlorophenyl)-7-ethenyl-1,4-oxazepane-4-carboxylic acid (PubChem CID 66974993) has the molecular formula C18H23Cl2NO3 and a molecular weight of 372.29 g/mol. Its IUPAC name is (6R,7S)-2-tert-butyl-6-(3,4-dichlorophenyl)-7-ethenyl-1,4-oxazepane-4-carboxylic acid.
| Compound Name | (6R,7S)-2-tert-butyl-6-(3,4-dichlorophenyl)-7-ethenyl-1,4-oxazepane-4-carboxylic acid |
|---|---|
| PubChem CID | 66974993 |
| Molecular Formula | C18H23Cl2NO3 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (6R,7S)-2-tert-butyl-6-(3,4-dichlorophenyl)-7-ethenyl-1,4-oxazepane-4-carboxylic acid |
| SMILES | C=C[C@@H]1OC(C(C)(C)C)CN(C(=O)O)C[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H23Cl2NO3/c1-5-15-12(11-6-7-13(19)14(20)8-11)9-21(17(22)23)10-16(24-15)18(2,3)4/h5-8,12,15-16H,1,9-10H2,2-4H3,(H,22,23)/t12-,15-,16?/m0/s1 |
| InChIKey | LBBJTCNULGRUPY-MUWBKCKESA-N |
| XLogP | 5.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|