C24H22FNO3 — CID 66976762
methyl 4-[(4-benzylbenzoyl)amino]-2-ethyl-3-fluorobenzoate (PubChem CID 66976762) has the molecular formula C24H22FNO3 and a molecular weight of 391.44 g/mol. Its IUPAC name is methyl 4-[(4-benzylbenzoyl)amino]-2-ethyl-3-fluorobenzoate.
| Compound Name | methyl 4-[(4-benzylbenzoyl)amino]-2-ethyl-3-fluorobenzoate |
|---|---|
| PubChem CID | 66976762 |
| Molecular Formula | C24H22FNO3 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | methyl 4-[(4-benzylbenzoyl)amino]-2-ethyl-3-fluorobenzoate |
| SMILES | CCc1c(C(=O)OC)ccc(NC(=O)c2ccc(Cc3ccccc3)cc2)c1F |
| InChI | InChI=1S/C24H22FNO3/c1-3-19-20(24(28)29-2)13-14-21(22(19)25)26-23(27)18-11-9-17(10-12-18)15-16-7-5-4-6-8-16/h4-14H,3,15H2,1-2H3,(H,26,27) |
| InChIKey | BDLXSFAIJPEGHE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |