C31H33Cl3N2O4 — CID 6698555
2,2,2-trichloro-N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6698555) has the molecular formula C31H33Cl3N2O4 and a molecular weight of 603.97 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6698555 |
| Molecular Formula | C31H33Cl3N2O4 |
| Molecular Weight | 603.97 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | 2,2,2-trichloro-N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | C=CCN(C)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(-c3cccc(CNC(=O)C(Cl)(Cl)Cl)c3)cc2)O1 |
| InChI | InChI=1S/C31H33Cl3N2O4/c1-3-15-36(2)19-27-17-28(24-9-7-21(20-37)8-10-24)40-29(39-27)25-13-11-23(12-14-25)26-6-4-5-22(16-26)18-35-30(38)31(32,33)34/h3-14,16,27-29,37H,1,15,17-20H2,2H3,(H,35,38)/t27-,28+,29+/m1/s1 |
| InChIKey | KJGKTEFESGCWNW-ULNSLHSMSA-N |
| XLogP | 6.50 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.97 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|