C27H32N2O4 — CID 66987125
ethyl 7,7-bis(7-methoxy-1H-indol-3-yl)heptanoate (PubChem CID 66987125) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is ethyl 7,7-bis(7-methoxy-1H-indol-3-yl)heptanoate.
| Compound Name | ethyl 7,7-bis(7-methoxy-1H-indol-3-yl)heptanoate |
|---|---|
| PubChem CID | 66987125 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | ethyl 7,7-bis(7-methoxy-1H-indol-3-yl)heptanoate |
| SMILES | CCOC(=O)CCCCCC(c1c[nH]c2c(OC)cccc12)c1c[nH]c2c(OC)cccc12 |
| InChI | InChI=1S/C27H32N2O4/c1-4-33-25(30)15-7-5-6-10-18(21-16-28-26-19(21)11-8-13-23(26)31-2)22-17-29-27-20(22)12-9-14-24(27)32-3/h8-9,11-14,16-18,28-29H,4-7,10,15H2,1-3H3 |
| InChIKey | CENDVDKOQNMNPT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|