About bis(2-benzylhydrazinyl) oxalate
bis(2-benzylhydrazinyl) oxalate (PubChem CID 66992005) has the molecular formula C16H18N4O4
and a molecular weight of 330.34 g/mol. Its IUPAC name is bis(2-benzylhydrazinyl) oxalate.
Molecular Properties
| Compound Name | bis(2-benzylhydrazinyl) oxalate |
| PubChem CID | 66992005 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | bis(2-benzylhydrazinyl) oxalate |
| SMILES | O=C(ONNCc1ccccc1)C(=O)ONNCc1ccccc1 |
| InChI | InChI=1S/C16H18N4O4/c21-15(23-19-17-11-13-7-3-1-4-8-13)16(22)24-20-18-12-14-9-5-2-6-10-14/h1-10,17-20H,11-12H2 |
| InChIKey | ZRAMUVVZRJCMGO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(2-benzylhydrazinyl) oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-benzylhydrazinyl) oxalate?
The IUPAC name of bis(2-benzylhydrazinyl) oxalate (CID 66992005) is bis(2-benzylhydrazinyl) oxalate.
What is the SMILES notation for bis(2-benzylhydrazinyl) oxalate?
The canonical SMILES for bis(2-benzylhydrazinyl) oxalate is O=C(ONNCc1ccccc1)C(=O)ONNCc1ccccc1.
What is the InChIKey of bis(2-benzylhydrazinyl) oxalate?
The InChIKey is ZRAMUVVZRJCMGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O4/c21-15(23-19-17-11-13-7-3-1-4-8-13)16(22)24-20-18-12-14-9-5-2-6-10-14/h1-10,17-20H,11-12H2.
What are the key properties of bis(2-benzylhydrazinyl) oxalate?
bis(2-benzylhydrazinyl) oxalate has a molecular weight of 330.34 g/mol, XLogP of 0.49, 8 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-benzylhydrazinyl) oxalate is sourced from PubChem (CID 66992005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).