C20H24N2O7 — CID 66992765
2-[4-(N-carbamoyl-3,4,5-trimethoxyanilino)phenoxy]-2-methylpropanoic acid (PubChem CID 66992765) has the molecular formula C20H24N2O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-[4-(N-carbamoyl-3,4,5-trimethoxyanilino)phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-(N-carbamoyl-3,4,5-trimethoxyanilino)phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66992765 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 2-[4-(N-carbamoyl-3,4,5-trimethoxyanilino)phenoxy]-2-methylpropanoic acid |
| SMILES | COc1cc(N(C(N)=O)c2ccc(OC(C)(C)C(=O)O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H24N2O7/c1-20(2,18(23)24)29-14-8-6-12(7-9-14)22(19(21)25)13-10-15(26-3)17(28-5)16(11-13)27-4/h6-11H,1-5H3,(H2,21,25)(H,23,24) |
| InChIKey | SZPWNTMANUYYFT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |