C20H12ClF3N4O2 — CID 66994916
methyl 4-[3-[(2-chloro-3,6-difluorophenyl)methyl]triazolo[4,5-b]pyridin-5-yl]-2-fluorobenzoate (PubChem CID 66994916) has the molecular formula C20H12ClF3N4O2 and a molecular weight of 432.79 g/mol. Its IUPAC name is methyl 4-[3-[(2-chloro-3,6-difluorophenyl)methyl]triazolo[4,5-b]pyridin-5-yl]-2-fluorobenzoate.
| Compound Name | methyl 4-[3-[(2-chloro-3,6-difluorophenyl)methyl]triazolo[4,5-b]pyridin-5-yl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 66994916 |
| Molecular Formula | C20H12ClF3N4O2 |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | methyl 4-[3-[(2-chloro-3,6-difluorophenyl)methyl]triazolo[4,5-b]pyridin-5-yl]-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(-c2ccc3nnn(Cc4c(F)ccc(F)c4Cl)c3n2)cc1F |
| InChI | InChI=1S/C20H12ClF3N4O2/c1-30-20(29)11-3-2-10(8-15(11)24)16-6-7-17-19(25-16)28(27-26-17)9-12-13(22)4-5-14(23)18(12)21/h2-8H,9H2,1H3 |
| InChIKey | HFDSLIGWNYUQCZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|