C20H28F3N3O2 — CID 66997448
(2S)-2-[[(3aR,4S,6aS)-2-[4-(trifluoromethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-N-methylpentanamide (PubChem CID 66997448) has the molecular formula C20H28F3N3O2 and a molecular weight of 399.46 g/mol. Its IUPAC name is (2S)-2-[[(3aR,4S,6aS)-2-[4-(trifluoromethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-N-methylpentanamide.
| Compound Name | (2S)-2-[[(3aR,4S,6aS)-2-[4-(trifluoromethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-N-methylpentanamide |
|---|---|
| PubChem CID | 66997448 |
| Molecular Formula | C20H28F3N3O2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | (2S)-2-[[(3aR,4S,6aS)-2-[4-(trifluoromethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-N-methylpentanamide |
| SMILES | CCC[C@H](N[C@H]1CC[C@@H]2CN(c3ccc(OC(F)(F)F)cc3)C[C@@H]21)C(=O)NC |
| InChI | InChI=1S/C20H28F3N3O2/c1-3-4-18(19(27)24-2)25-17-10-5-13-11-26(12-16(13)17)14-6-8-15(9-7-14)28-20(21,22)23/h6-9,13,16-18,25H,3-5,10-12H2,1-2H3,(H,24,27)/t13-,16+,17+,18+/m1/s1 |
| InChIKey | XTQXTCVFJWUWTD-QCSYZSNVSA-N |
| XLogP | 3.30 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|