C23H23F4N3O — CID 66996576
(3aR,4S,6aS)-N-[(5-fluoro-1H-indol-2-yl)methyl]-2-[4-(trifluoromethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 66996576) has the molecular formula C23H23F4N3O and a molecular weight of 433.45 g/mol. Its IUPAC name is (3aR,4S,6aS)-N-[(5-fluoro-1H-indol-2-yl)methyl]-2-[4-(trifluoromethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aR,4S,6aS)-N-[(5-fluoro-1H-indol-2-yl)methyl]-2-[4-(trifluoromethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 66996576 |
| Molecular Formula | C23H23F4N3O |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (3aR,4S,6aS)-N-[(5-fluoro-1H-indol-2-yl)methyl]-2-[4-(trifluoromethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | Fc1ccc2[nH]c(CN[C@H]3CC[C@@H]4CN(c5ccc(OC(F)(F)F)cc5)C[C@@H]43)cc2c1 |
| InChI | InChI=1S/C23H23F4N3O/c24-16-2-8-21-15(9-16)10-17(29-21)11-28-22-7-1-14-12-30(13-20(14)22)18-3-5-19(6-4-18)31-23(25,26)27/h2-6,8-10,14,20,22,28-29H,1,7,11-13H2/t14-,20+,22+/m1/s1 |
| InChIKey | XIWFWFKNDHYOFQ-XDCJIHQESA-N |
| XLogP | 5.21 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|