C24H26F3N5O — CID 66997478
(3aR,4S,6aS)-N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 66997478) has the molecular formula C24H26F3N5O and a molecular weight of 457.50 g/mol. Its IUPAC name is (3aR,4S,6aS)-N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aR,4S,6aS)-N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 66997478 |
| Molecular Formula | C24H26F3N5O |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | (3aR,4S,6aS)-N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | COc1ccc(-c2[nH]ncc2CN[C@H]2CC[C@@H]3CN(c4cccc(C(F)(F)F)n4)C[C@@H]32)cc1 |
| InChI | InChI=1S/C24H26F3N5O/c1-33-18-8-5-15(6-9-18)23-17(12-29-31-23)11-28-20-10-7-16-13-32(14-19(16)20)22-4-2-3-21(30-22)24(25,26)27/h2-6,8-9,12,16,19-20,28H,7,10-11,13-14H2,1H3,(H,29,31)/t16-,19+,20+/m1/s1 |
| InChIKey | IRSCYNPULPWILW-UXPWSPDFSA-N |
| XLogP | 4.50 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |