C16H17F6N3O2 — CID 87229653
(2S)-N-[(3aR,4S,6aS)-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3,3,3-trifluoro-2-hydroxypropanamide (PubChem CID 87229653) has the molecular formula C16H17F6N3O2 and a molecular weight of 397.32 g/mol. Its IUPAC name is (2S)-N-[(3aR,4S,6aS)-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3,3,3-trifluoro-2-hydroxypropanamide.
| Compound Name | (2S)-N-[(3aR,4S,6aS)-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3,3,3-trifluoro-2-hydroxypropanamide |
|---|---|
| PubChem CID | 87229653 |
| Molecular Formula | C16H17F6N3O2 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (2S)-N-[(3aR,4S,6aS)-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3,3,3-trifluoro-2-hydroxypropanamide |
| SMILES | O=C(N[C@H]1CC[C@@H]2CN(c3cccc(C(F)(F)F)n3)C[C@@H]21)[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C16H17F6N3O2/c17-15(18,19)11-2-1-3-12(24-11)25-6-8-4-5-10(9(8)7-25)23-14(27)13(26)16(20,21)22/h1-3,8-10,13,26H,4-7H2,(H,23,27)/t8-,9+,10+,13+/m1/s1 |
| InChIKey | RSDFOTNSZFPYPE-QYTUQVAYSA-N |
| XLogP | 2.35 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |