C17H20F3N5 — CID 54673199
(3aR,4S,6aS)-N-(1H-pyrazol-5-ylmethyl)-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 54673199) has the molecular formula C17H20F3N5 and a molecular weight of 351.38 g/mol. Its IUPAC name is (3aR,4S,6aS)-N-(1H-pyrazol-5-ylmethyl)-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aR,4S,6aS)-N-(1H-pyrazol-5-ylmethyl)-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 54673199 |
| Molecular Formula | C17H20F3N5 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (3aR,4S,6aS)-N-(1H-pyrazol-5-ylmethyl)-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | FC(F)(F)c1cccc(N2C[C@H]3CC[C@H](NCc4ccn[nH]4)[C@H]3C2)n1 |
| InChI | InChI=1S/C17H20F3N5/c18-17(19,20)15-2-1-3-16(23-15)25-9-11-4-5-14(13(11)10-25)21-8-12-6-7-22-24-12/h1-3,6-7,11,13-14,21H,4-5,8-10H2,(H,22,24)/t11-,13+,14+/m1/s1 |
| InChIKey | BNJWTVBOPCGFRO-XBFCOCLRSA-N |
| XLogP | 2.83 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |