C21H24F3N3 — CID 66996534
(3aR,4S,6aS)-N-[(4-methylphenyl)methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 66996534) has the molecular formula C21H24F3N3 and a molecular weight of 375.44 g/mol. Its IUPAC name is (3aR,4S,6aS)-N-[(4-methylphenyl)methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aR,4S,6aS)-N-[(4-methylphenyl)methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 66996534 |
| Molecular Formula | C21H24F3N3 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (3aR,4S,6aS)-N-[(4-methylphenyl)methyl]-2-[6-(trifluoromethyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | Cc1ccc(CN[C@H]2CC[C@@H]3CN(c4cccc(C(F)(F)F)n4)C[C@@H]32)cc1 |
| InChI | InChI=1S/C21H24F3N3/c1-14-5-7-15(8-6-14)11-25-18-10-9-16-12-27(13-17(16)18)20-4-2-3-19(26-20)21(22,23)24/h2-8,16-18,25H,9-13H2,1H3/t16-,17+,18+/m1/s1 |
| InChIKey | VLXDXJVSMISLRY-SQNIBIBYSA-N |
| XLogP | 4.41 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |