C29H26N2O5S2 — CID 67001095
3-(benzenesulfonyl)-6-[3-(3-methylsulfonylphenyl)phenyl]-1-phenylpiperazin-2-one (PubChem CID 67001095) has the molecular formula C29H26N2O5S2 and a molecular weight of 546.67 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-6-[3-(3-methylsulfonylphenyl)phenyl]-1-phenylpiperazin-2-one.
| Compound Name | 3-(benzenesulfonyl)-6-[3-(3-methylsulfonylphenyl)phenyl]-1-phenylpiperazin-2-one |
|---|---|
| PubChem CID | 67001095 |
| Molecular Formula | C29H26N2O5S2 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | 3-(benzenesulfonyl)-6-[3-(3-methylsulfonylphenyl)phenyl]-1-phenylpiperazin-2-one |
| SMILES | CS(=O)(=O)c1cccc(-c2cccc(C3CNC(S(=O)(=O)c4ccccc4)C(=O)N3c3ccccc3)c2)c1 |
| InChI | InChI=1S/C29H26N2O5S2/c1-37(33,34)26-17-9-11-22(19-26)21-10-8-12-23(18-21)27-20-30-28(38(35,36)25-15-6-3-7-16-25)29(32)31(27)24-13-4-2-5-14-24/h2-19,27-28,30H,20H2,1H3 |
| InChIKey | DGWFJOXLOMZVNA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |