C21H26N6O2 — CID 67001525
morpholin-4-yl-(3-pyrimidin-2-yl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl)methanone (PubChem CID 67001525) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is morpholin-4-yl-(3-pyrimidin-2-yl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl)methanone.
| Compound Name | morpholin-4-yl-(3-pyrimidin-2-yl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl)methanone |
|---|---|
| PubChem CID | 67001525 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | morpholin-4-yl-(3-pyrimidin-2-yl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl)methanone |
| SMILES | O=C(N1CCOCC1)N1Cc2ccccc2N2CCN(c3ncccn3)CC2C1 |
| InChI | InChI=1S/C21H26N6O2/c28-21(24-10-12-29-13-11-24)26-14-17-4-1-2-5-19(17)27-9-8-25(15-18(27)16-26)20-22-6-3-7-23-20/h1-7,18H,8-16H2 |
| InChIKey | OCMLMTOMXJECSN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 65.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |