C21H27N5O — CID 99732753
(4aR,5R)-N-(2-methylpropyl)-3-pyrimidin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 99732753) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is (4aR,5R)-N-(2-methylpropyl)-3-pyrimidin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5R)-N-(2-methylpropyl)-3-pyrimidin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 99732753 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (4aR,5R)-N-(2-methylpropyl)-3-pyrimidin-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CC(C)CNC(=O)[C@@H]1Cc2ccccc2N2CCN(c3ncccn3)C[C@@H]12 |
| InChI | InChI=1S/C21H27N5O/c1-15(2)13-24-20(27)17-12-16-6-3-4-7-18(16)26-11-10-25(14-19(17)26)21-22-8-5-9-23-21/h3-9,15,17,19H,10-14H2,1-2H3,(H,24,27)/t17-,19+/m1/s1 |
| InChIKey | OUGWSOGKVNSSQN-MJGOQNOKSA-N |
| XLogP | 2.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |