C23H34N2O6 — CID 67009674
5-[methoxy-(2-methoxyphenyl)methylidene]-3-octan-3-ylimidazolidine-2,4-dione;propanoic acid (PubChem CID 67009674) has the molecular formula C23H34N2O6 and a molecular weight of 434.53 g/mol. Its IUPAC name is 5-[methoxy-(2-methoxyphenyl)methylidene]-3-octan-3-ylimidazolidine-2,4-dione;propanoic acid.
| Compound Name | 5-[methoxy-(2-methoxyphenyl)methylidene]-3-octan-3-ylimidazolidine-2,4-dione;propanoic acid |
|---|---|
| PubChem CID | 67009674 |
| Molecular Formula | C23H34N2O6 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 5-[methoxy-(2-methoxyphenyl)methylidene]-3-octan-3-ylimidazolidine-2,4-dione;propanoic acid |
| SMILES | CCC(=O)O.CCCCCC(CC)N1C(=O)NC(=C(OC)c2ccccc2OC)C1=O |
| InChI | InChI=1S/C20H28N2O4.C3H6O2/c1-5-7-8-11-14(6-2)22-19(23)17(21-20(22)24)18(26-4)15-12-9-10-13-16(15)25-3;1-2-3(4)5/h9-10,12-14H,5-8,11H2,1-4H3,(H,21,24);2H2,1H3,(H,4,5) |
| InChIKey | RXTDUHGYKHBCRG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|