C23H34N2O6 — CID 139491402
2-ethylhexyl propanoate;5-[methoxy-(2-methoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 139491402) has the molecular formula C23H34N2O6 and a molecular weight of 434.53 g/mol. Its IUPAC name is 2-ethylhexyl propanoate;5-[methoxy-(2-methoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | 2-ethylhexyl propanoate;5-[methoxy-(2-methoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139491402 |
| Molecular Formula | C23H34N2O6 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2-ethylhexyl propanoate;5-[methoxy-(2-methoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | CCCCC(CC)COC(=O)CC.COC(=C1NC(=O)NC1=O)c1ccccc1OC |
| InChI | InChI=1S/C12H12N2O4.C11H22O2/c1-17-8-6-4-3-5-7(8)10(18-2)9-11(15)14-12(16)13-9;1-4-7-8-10(5-2)9-13-11(12)6-3/h3-6H,1-2H3,(H2,13,14,15,16);10H,4-9H2,1-3H3 |
| InChIKey | UYVXEZHNCGORRE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|