C23H36N2O5 — CID 130237911
1-(2-ethylhexyl)-5-[methoxy-(2-methoxyphenyl)methylidene]imidazolidin-2-one;propanoic acid (PubChem CID 130237911) has the molecular formula C23H36N2O5 and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-5-[methoxy-(2-methoxyphenyl)methylidene]imidazolidin-2-one;propanoic acid.
| Compound Name | 1-(2-ethylhexyl)-5-[methoxy-(2-methoxyphenyl)methylidene]imidazolidin-2-one;propanoic acid |
|---|---|
| PubChem CID | 130237911 |
| Molecular Formula | C23H36N2O5 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 1-(2-ethylhexyl)-5-[methoxy-(2-methoxyphenyl)methylidene]imidazolidin-2-one;propanoic acid |
| SMILES | CCC(=O)O.CCCCC(CC)CN1C(=O)NCC1=C(OC)c1ccccc1OC |
| InChI | InChI=1S/C20H30N2O3.C3H6O2/c1-5-7-10-15(6-2)14-22-17(13-21-20(22)23)19(25-4)16-11-8-9-12-18(16)24-3;1-2-3(4)5/h8-9,11-12,15H,5-7,10,13-14H2,1-4H3,(H,21,23);2H2,1H3,(H,4,5) |
| InChIKey | FECJWIWYDNTHEQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|