C34H31NO5 — CID 137492222
6-benzoyl-2-(2-ethylhexyl)-7-(2-hydroxybenzoyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 137492222) has the molecular formula C34H31NO5 and a molecular weight of 533.62 g/mol. Its IUPAC name is 6-benzoyl-2-(2-ethylhexyl)-7-(2-hydroxybenzoyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-benzoyl-2-(2-ethylhexyl)-7-(2-hydroxybenzoyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 137492222 |
| Molecular Formula | C34H31NO5 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 6-benzoyl-2-(2-ethylhexyl)-7-(2-hydroxybenzoyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCC(CC)CN1C(=O)c2ccc(C(=O)c3ccccc3)c3c(C(=O)c4ccccc4O)ccc(c23)C1=O |
| InChI | InChI=1S/C34H31NO5/c1-3-5-11-21(4-2)20-35-33(39)26-18-16-24(31(37)22-12-7-6-8-13-22)29-25(17-19-27(30(26)29)34(35)40)32(38)23-14-9-10-15-28(23)36/h6-10,12-19,21,36H,3-5,11,20H2,1-2H3 |
| InChIKey | OLWYTQNEESAUQK-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|