C20H28N2O4 — CID 67140706
1-ethyl-3-hexyl-5-[methoxy-(2-methoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 67140706) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 1-ethyl-3-hexyl-5-[methoxy-(2-methoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | 1-ethyl-3-hexyl-5-[methoxy-(2-methoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 67140706 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-ethyl-3-hexyl-5-[methoxy-(2-methoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | CCCCCCN1C(=O)C(=C(OC)c2ccccc2OC)N(CC)C1=O |
| InChI | InChI=1S/C20H28N2O4/c1-5-7-8-11-14-22-19(23)17(21(6-2)20(22)24)18(26-4)15-12-9-10-13-16(15)25-3/h9-10,12-13H,5-8,11,14H2,1-4H3 |
| InChIKey | SVUPZHHCLUDGKU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|