C35H37FN4O5 — CID 67009799
N-[4-(4-fluorophenoxy)phenyl]-2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]amino]-3-phenylmethoxypropanamide (PubChem CID 67009799) has the molecular formula C35H37FN4O5 and a molecular weight of 612.70 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)phenyl]-2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]amino]-3-phenylmethoxypropanamide.
| Compound Name | N-[4-(4-fluorophenoxy)phenyl]-2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]amino]-3-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 67009799 |
| Molecular Formula | C35H37FN4O5 |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | N-[4-(4-fluorophenoxy)phenyl]-2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]amino]-3-phenylmethoxypropanamide |
| SMILES | COc1ccc(N2CCN(CC(=O)NC(COCc3ccccc3)C(=O)Nc3ccc(Oc4ccc(F)cc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C35H37FN4O5/c1-43-30-17-11-29(12-18-30)40-21-19-39(20-22-40)23-34(41)38-33(25-44-24-26-5-3-2-4-6-26)35(42)37-28-9-15-32(16-10-28)45-31-13-7-27(36)8-14-31/h2-18,33H,19-25H2,1H3,(H,37,42)(H,38,41) |
| InChIKey | BEHISQNTTXCREA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|