C17H13Cl4NO — CID 67017784
N-[(5,7-dichloro-1-benzofuran-2-yl)methyl]-2-(3,4-dichlorophenyl)ethanamine (PubChem CID 67017784) has the molecular formula C17H13Cl4NO and a molecular weight of 389.11 g/mol. Its IUPAC name is N-[(5,7-dichloro-1-benzofuran-2-yl)methyl]-2-(3,4-dichlorophenyl)ethanamine.
| Compound Name | N-[(5,7-dichloro-1-benzofuran-2-yl)methyl]-2-(3,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 67017784 |
| Molecular Formula | C17H13Cl4NO |
| Molecular Weight | 389.11 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | N-[(5,7-dichloro-1-benzofuran-2-yl)methyl]-2-(3,4-dichlorophenyl)ethanamine |
| SMILES | Clc1cc(Cl)c2oc(CNCCc3ccc(Cl)c(Cl)c3)cc2c1 |
| InChI | InChI=1S/C17H13Cl4NO/c18-12-6-11-7-13(23-17(11)16(21)8-12)9-22-4-3-10-1-2-14(19)15(20)5-10/h1-2,5-8,22H,3-4,9H2 |
| InChIKey | IIJMSYAFZGDCJR-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.11 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|