C13H11N3O2 — CID 67025334
(7-cyano-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)carbamic acid (PubChem CID 67025334) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is (7-cyano-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)carbamic acid.
| Compound Name | (7-cyano-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)carbamic acid |
|---|---|
| PubChem CID | 67025334 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (7-cyano-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)carbamic acid |
| SMILES | N#Cc1ccc2[nH]c3c(c2c1)CC(NC(=O)O)C3 |
| InChI | InChI=1S/C13H11N3O2/c14-6-7-1-2-11-9(3-7)10-4-8(15-13(17)18)5-12(10)16-11/h1-3,8,15-16H,4-5H2,(H,17,18) |
| InChIKey | WLNWBRRUSXTXME-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|