C17H8BrF3N2O2 — CID 67032978
2-(bromomethyl)-4-(1,3-dioxoisoindol-2-yl)-6-(trifluoromethyl)benzonitrile (PubChem CID 67032978) has the molecular formula C17H8BrF3N2O2 and a molecular weight of 409.16 g/mol. Its IUPAC name is 2-(bromomethyl)-4-(1,3-dioxoisoindol-2-yl)-6-(trifluoromethyl)benzonitrile.
| Compound Name | 2-(bromomethyl)-4-(1,3-dioxoisoindol-2-yl)-6-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 67032978 |
| Molecular Formula | C17H8BrF3N2O2 |
| Molecular Weight | 409.16 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | 2-(bromomethyl)-4-(1,3-dioxoisoindol-2-yl)-6-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1c(CBr)cc(N2C(=O)c3ccccc3C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C17H8BrF3N2O2/c18-7-9-5-10(6-14(13(9)8-22)17(19,20)21)23-15(24)11-3-1-2-4-12(11)16(23)25/h1-6H,7H2 |
| InChIKey | AKDUSFHBZKQESW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.16 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|