C42H62F3N3O5 — CID 6703815
(2S)-N-[[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 6703815) has the molecular formula C42H62F3N3O5 and a molecular weight of 745.97 g/mol. Its IUPAC name is (2S)-N-[[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6703815 |
| Molecular Formula | C42H62F3N3O5 |
| Molecular Weight | 745.97 g/mol |
| Exact Mass | 745.46 |
| IUPAC Name | (2S)-N-[[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(CNC(=O)[C@@H]3CCCN3C(=O)C(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C42H62F3N3O5/c1-3-5-7-9-11-13-25-47(26-14-12-10-8-6-4-2)30-36-28-38(34-21-19-33(31-49)20-22-34)53-40(52-36)35-23-17-32(18-24-35)29-46-39(50)37-16-15-27-48(37)41(51)42(43,44)45/h17-24,36-38,40,49H,3-16,25-31H2,1-2H3,(H,46,50)/t36-,37+,38+,40+/m1/s1 |
| InChIKey | XHLXGAHQCSJMEQ-OEBBATAPSA-N |
| XLogP | 8.92 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.97 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|