About triazolo[4,5-i][1]benzazepine
triazolo[4,5-i][1]benzazepine (PubChem CID 67039107) has the molecular formula C10H6N4
and a molecular weight of 182.19 g/mol. Its IUPAC name is triazolo[4,5-i][1]benzazepine.
Molecular Properties
| Compound Name | triazolo[4,5-i][1]benzazepine |
| PubChem CID | 67039107 |
| Molecular Formula | C10H6N4 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | triazolo[4,5-i][1]benzazepine |
| SMILES | c1ccc2ccc3nnnc3c2nc1 |
| InChI | InChI=1S/C10H6N4/c1-2-6-11-9-7(3-1)4-5-8-10(9)13-14-12-8/h1-6H |
| InChIKey | QDEVEJYEXBFIJD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze triazolo[4,5-i][1]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazolo[4,5-i][1]benzazepine?
The IUPAC name of triazolo[4,5-i][1]benzazepine (CID 67039107) is triazolo[4,5-i][1]benzazepine.
What is the SMILES notation for triazolo[4,5-i][1]benzazepine?
The canonical SMILES for triazolo[4,5-i][1]benzazepine is c1ccc2ccc3nnnc3c2nc1.
What is the InChIKey of triazolo[4,5-i][1]benzazepine?
The InChIKey is QDEVEJYEXBFIJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N4/c1-2-6-11-9-7(3-1)4-5-8-10(9)13-14-12-8/h1-6H.
What are the key properties of triazolo[4,5-i][1]benzazepine?
triazolo[4,5-i][1]benzazepine has a molecular weight of 182.19 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triazolo[4,5-i][1]benzazepine is sourced from PubChem (CID 67039107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).