C22H15BrCl3N3O5S — CID 67040512
2,2,2-trichloroethyl N-[4-[4-[(4-bromophenyl)carbamoyl]-2-nitrophenyl]sulfanylphenyl]carbamate (PubChem CID 67040512) has the molecular formula C22H15BrCl3N3O5S and a molecular weight of 619.71 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[4-[4-[(4-bromophenyl)carbamoyl]-2-nitrophenyl]sulfanylphenyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[4-[4-[(4-bromophenyl)carbamoyl]-2-nitrophenyl]sulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 67040512 |
| Molecular Formula | C22H15BrCl3N3O5S |
| Molecular Weight | 619.71 g/mol |
| Exact Mass | 616.90 |
| IUPAC Name | 2,2,2-trichloroethyl N-[4-[4-[(4-bromophenyl)carbamoyl]-2-nitrophenyl]sulfanylphenyl]carbamate |
| SMILES | O=C(Nc1ccc(Sc2ccc(C(=O)Nc3ccc(Br)cc3)cc2[N+](=O)[O-])cc1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H15BrCl3N3O5S/c23-14-2-4-15(5-3-14)27-20(30)13-1-10-19(18(11-13)29(32)33)35-17-8-6-16(7-9-17)28-21(31)34-12-22(24,25)26/h1-11H,12H2,(H,27,30)(H,28,31) |
| InChIKey | XVGJXIWOUBJACK-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.71 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|