C25H31Cl3N2O6 — CID 67046618
(E)-6-[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trichloroacetyl)amino]-1H-2-benzofuran-5-yl]-4-methyl-2-(2-pyrrolidin-1-ylethyl)hex-4-enoic acid (PubChem CID 67046618) has the molecular formula C25H31Cl3N2O6 and a molecular weight of 561.89 g/mol. Its IUPAC name is (E)-6-[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trichloroacetyl)amino]-1H-2-benzofuran-5-yl]-4-methyl-2-(2-pyrrolidin-1-ylethyl)hex-4-enoic acid.
| Compound Name | (E)-6-[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trichloroacetyl)amino]-1H-2-benzofuran-5-yl]-4-methyl-2-(2-pyrrolidin-1-ylethyl)hex-4-enoic acid |
|---|---|
| PubChem CID | 67046618 |
| Molecular Formula | C25H31Cl3N2O6 |
| Molecular Weight | 561.89 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | (E)-6-[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trichloroacetyl)amino]-1H-2-benzofuran-5-yl]-4-methyl-2-(2-pyrrolidin-1-ylethyl)hex-4-enoic acid |
| SMILES | COc1c(C)c2c(c(NC(=O)C(Cl)(Cl)Cl)c1C/C=C(\C)CC(CCN1CCCC1)C(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C25H31Cl3N2O6/c1-14(12-16(22(31)32)8-11-30-9-4-5-10-30)6-7-17-20(29-24(34)25(26,27)28)19-18(13-36-23(19)33)15(2)21(17)35-3/h6,16H,4-5,7-13H2,1-3H3,(H,29,34)(H,31,32)/b14-6+ |
| InChIKey | UNYHTLZQRHTMFW-MKMNVTDBSA-N |
| XLogP | 5.05 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.89 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|