C16H12F3N3S — CID 67053494
3-(2,4-diaminophenyl)sulfanyl-2-[2-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 67053494) has the molecular formula C16H12F3N3S and a molecular weight of 335.35 g/mol. Its IUPAC name is 3-(2,4-diaminophenyl)sulfanyl-2-[2-(trifluoromethyl)phenyl]prop-2-enenitrile.
| Compound Name | 3-(2,4-diaminophenyl)sulfanyl-2-[2-(trifluoromethyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 67053494 |
| Molecular Formula | C16H12F3N3S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 3-(2,4-diaminophenyl)sulfanyl-2-[2-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | N#CC(=CSc1ccc(N)cc1N)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H12F3N3S/c17-16(18,19)13-4-2-1-3-12(13)10(8-20)9-23-15-6-5-11(21)7-14(15)22/h1-7,9H,21-22H2 |
| InChIKey | IECXAZAICFABIR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|