C19H29NO — CID 67055776
(8S,10R,13S,14S)-17-amino-10,13-dimethyl-3,4,5,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 67055776) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (8S,10R,13S,14S)-17-amino-10,13-dimethyl-3,4,5,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,10R,13S,14S)-17-amino-10,13-dimethyl-3,4,5,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 67055776 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (8S,10R,13S,14S)-17-amino-10,13-dimethyl-3,4,5,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC=C3[C@@H](CCC4CCC=C[C@]34C)[C@@H]1CCC2(N)O |
| InChI | InChI=1S/C19H29NO/c1-17-10-4-3-5-13(17)6-7-14-15(17)8-11-18(2)16(14)9-12-19(18,20)21/h4,8,10,13-14,16,21H,3,5-7,9,11-12,20H2,1-2H3/t13?,14-,16+,17+,18+,19?/m1/s1 |
| InChIKey | UFFXTODQCOASRE-SNRGTSIXSA-N |
| XLogP | 3.76 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|