C19H29NO2 — CID 69398835
(10R,13S,14S)-7-amino-10,13-dimethyl-3,4,5,6,7,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,17-diol (PubChem CID 69398835) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (10R,13S,14S)-7-amino-10,13-dimethyl-3,4,5,6,7,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,17-diol.
| Compound Name | (10R,13S,14S)-7-amino-10,13-dimethyl-3,4,5,6,7,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,17-diol |
|---|---|
| PubChem CID | 69398835 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (10R,13S,14S)-7-amino-10,13-dimethyl-3,4,5,6,7,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,17-diol |
| SMILES | C[C@]12CCC3=C(C(N)CC4CCC=C[C@]34C)[C@@H]1CCC2(O)O |
| InChI | InChI=1S/C19H29NO2/c1-17-8-4-3-5-12(17)11-15(20)16-13(17)6-9-18(2)14(16)7-10-19(18,21)22/h4,8,12,14-15,21-22H,3,5-7,9-11,20H2,1-2H3/t12?,14-,15?,17-,18-/m0/s1 |
| InChIKey | AZOCWSBXOVCVPR-RSZKYGPWSA-N |
| XLogP | 2.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|