C21H36O — CID 142950805
1-(1,2,4b-trimethyl-1,3,4,7,8,8a,9,10-octahydrophenanthren-2-yl)ethanol;ethane (PubChem CID 142950805) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is 1-(1,2,4b-trimethyl-1,3,4,7,8,8a,9,10-octahydrophenanthren-2-yl)ethanol;ethane.
| Compound Name | 1-(1,2,4b-trimethyl-1,3,4,7,8,8a,9,10-octahydrophenanthren-2-yl)ethanol;ethane |
|---|---|
| PubChem CID | 142950805 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | 1-(1,2,4b-trimethyl-1,3,4,7,8,8a,9,10-octahydrophenanthren-2-yl)ethanol;ethane |
| SMILES | CC.CC(O)C1(C)CCC2=C(CCC3CCC=CC23C)C1C |
| InChI | InChI=1S/C19H30O.C2H6/c1-13-16-9-8-15-7-5-6-11-19(15,4)17(16)10-12-18(13,3)14(2)20;1-2/h6,11,13-15,20H,5,7-10,12H2,1-4H3;1-2H3 |
| InChIKey | XFIGQJMYPFNBTC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|