C20H30O2 — CID 69493041
(9S,10R,13S,14S)-7,10,13-trimethyl-3,4,5,6,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,17-diol (PubChem CID 69493041) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (9S,10R,13S,14S)-7,10,13-trimethyl-3,4,5,6,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,17-diol.
| Compound Name | (9S,10R,13S,14S)-7,10,13-trimethyl-3,4,5,6,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,17-diol |
|---|---|
| PubChem CID | 69493041 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (9S,10R,13S,14S)-7,10,13-trimethyl-3,4,5,6,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,17-diol |
| SMILES | CC1=C2[C@@H](CC[C@@]3(C)[C@H]2CCC3(O)O)[C@@]2(C)C=CCCC2C1 |
| InChI | InChI=1S/C20H30O2/c1-13-12-14-6-4-5-9-18(14,2)15-7-10-19(3)16(17(13)15)8-11-20(19,21)22/h5,9,14-16,21-22H,4,6-8,10-12H2,1-3H3/t14?,15-,16+,18+,19+/m1/s1 |
| InChIKey | OPIOKJBOMMLTBC-ZIKSQYSGSA-N |
| XLogP | 4.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|