C16H20N4O4 — CID 67060410
tert-butyl-[(3S)-3-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]carbamic acid (PubChem CID 67060410) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is tert-butyl-[(3S)-3-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]carbamic acid.
| Compound Name | tert-butyl-[(3S)-3-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 67060410 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | tert-butyl-[(3S)-3-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@]1(c2ccc([N+](=O)[O-])cc2C#N)CCNC1 |
| InChI | InChI=1S/C16H20N4O4/c1-15(2,3)19(14(21)22)16(6-7-18-10-16)13-5-4-12(20(23)24)8-11(13)9-17/h4-5,8,18H,6-7,10H2,1-3H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | OFYXVQSRJYVGGH-MRXNPFEDSA-N |
| XLogP | 2.43 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|