C17H24ClN5O3 — CID 67060411
(2S)-2-[[(3S)-1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]amino]-4-methylpentanamide;hydrochloride (PubChem CID 67060411) has the molecular formula C17H24ClN5O3 and a molecular weight of 381.86 g/mol. Its IUPAC name is (2S)-2-[[(3S)-1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]amino]-4-methylpentanamide;hydrochloride.
| Compound Name | (2S)-2-[[(3S)-1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]amino]-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 67060411 |
| Molecular Formula | C17H24ClN5O3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (2S)-2-[[(3S)-1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]amino]-4-methylpentanamide;hydrochloride |
| SMILES | CC(C)C[C@H](N[C@H]1CCN(c2ccc([N+](=O)[O-])cc2C#N)C1)C(N)=O.Cl |
| InChI | InChI=1S/C17H23N5O3.ClH/c1-11(2)7-15(17(19)23)20-13-5-6-21(10-13)16-4-3-14(22(24)25)8-12(16)9-18;/h3-4,8,11,13,15,20H,5-7,10H2,1-2H3,(H2,19,23);1H/t13-,15-;/m0./s1 |
| InChIKey | OKHWNZBRAQWPBJ-SLHAJLBXSA-N |
| XLogP | 1.96 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|