C18H19N5O3S — CID 67060644
(2S)-2-[[(3S)-1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]amino]-3-thiophen-3-ylpropanamide (PubChem CID 67060644) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is (2S)-2-[[(3S)-1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]amino]-3-thiophen-3-ylpropanamide.
| Compound Name | (2S)-2-[[(3S)-1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]amino]-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 67060644 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (2S)-2-[[(3S)-1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]amino]-3-thiophen-3-ylpropanamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1N1CC[C@H](N[C@@H](Cc2ccsc2)C(N)=O)C1 |
| InChI | InChI=1S/C18H19N5O3S/c19-9-13-8-15(23(25)26)1-2-17(13)22-5-3-14(10-22)21-16(18(20)24)7-12-4-6-27-11-12/h1-2,4,6,8,11,14,16,21H,3,5,7,10H2,(H2,20,24)/t14-,16-/m0/s1 |
| InChIKey | MWROZCULEDCYBK-HOCLYGCPSA-N |
| XLogP | 1.79 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|