C16H22ClN5O3 — CID 67060483
(2S)-2-[[(3S)-1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]amino]pentanamide;hydrochloride (PubChem CID 67060483) has the molecular formula C16H22ClN5O3 and a molecular weight of 367.84 g/mol. Its IUPAC name is (2S)-2-[[(3S)-1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]amino]pentanamide;hydrochloride.
| Compound Name | (2S)-2-[[(3S)-1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]amino]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 67060483 |
| Molecular Formula | C16H22ClN5O3 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2S)-2-[[(3S)-1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]amino]pentanamide;hydrochloride |
| SMILES | CCC[C@H](N[C@H]1CCN(c2ccc([N+](=O)[O-])cc2C#N)C1)C(N)=O.Cl |
| InChI | InChI=1S/C16H21N5O3.ClH/c1-2-3-14(16(18)22)19-12-6-7-20(10-12)15-5-4-13(21(23)24)8-11(15)9-17;/h4-5,8,12,14,19H,2-3,6-7,10H2,1H3,(H2,18,22);1H/t12-,14-;/m0./s1 |
| InChIKey | YSKFCZKFTMXQHS-KYSPHBLOSA-N |
| XLogP | 1.71 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|