About 2H-pyridine-1,3-diamine
2H-pyridine-1,3-diamine (PubChem CID 67060954) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 2H-pyridine-1,3-diamine.
Molecular Properties
| Compound Name | 2H-pyridine-1,3-diamine |
| PubChem CID | 67060954 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 2H-pyridine-1,3-diamine |
| SMILES | NC1=CC=CN(N)C1 |
| InChI | InChI=1S/C5H9N3/c6-5-2-1-3-8(7)4-5/h1-3H,4,6-7H2 |
| InChIKey | CSFJNONRMLTUOZ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2H-pyridine-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyridine-1,3-diamine?
The IUPAC name of 2H-pyridine-1,3-diamine (CID 67060954) is 2H-pyridine-1,3-diamine.
What is the SMILES notation for 2H-pyridine-1,3-diamine?
The canonical SMILES for 2H-pyridine-1,3-diamine is NC1=CC=CN(N)C1.
What is the InChIKey of 2H-pyridine-1,3-diamine?
The InChIKey is CSFJNONRMLTUOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c6-5-2-1-3-8(7)4-5/h1-3H,4,6-7H2.
What are the key properties of 2H-pyridine-1,3-diamine?
2H-pyridine-1,3-diamine has a molecular weight of 111.15 g/mol, XLogP of -0.47, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyridine-1,3-diamine is sourced from PubChem (CID 67060954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).