C6H13N5 — CID 70273246
1-prop-2-enyl-2,4-dihydrotriazine-3,5-diamine (PubChem CID 70273246) has the molecular formula C6H13N5 and a molecular weight of 155.20 g/mol. Its IUPAC name is 1-prop-2-enyl-2,4-dihydrotriazine-3,5-diamine.
| Compound Name | 1-prop-2-enyl-2,4-dihydrotriazine-3,5-diamine |
|---|---|
| PubChem CID | 70273246 |
| Molecular Formula | C6H13N5 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.12 |
| IUPAC Name | 1-prop-2-enyl-2,4-dihydrotriazine-3,5-diamine |
| SMILES | C=CCN1C=C(N)CN(N)N1 |
| InChI | InChI=1S/C6H13N5/c1-2-3-10-4-6(7)5-11(8)9-10/h2,4,9H,1,3,5,7-8H2 |
| InChIKey | MNHDWSFWWSMYNK-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 70.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|