C12H15ClN6O — CID 67064112
5-[2-[5-(furan-2-ylmethyl)-2H-triazol-4-yl]ethyl]-1H-imidazol-2-amine;hydrochloride (PubChem CID 67064112) has the molecular formula C12H15ClN6O and a molecular weight of 294.75 g/mol. Its IUPAC name is 5-[2-[5-(furan-2-ylmethyl)-2H-triazol-4-yl]ethyl]-1H-imidazol-2-amine;hydrochloride.
| Compound Name | 5-[2-[5-(furan-2-ylmethyl)-2H-triazol-4-yl]ethyl]-1H-imidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 67064112 |
| Molecular Formula | C12H15ClN6O |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-[2-[5-(furan-2-ylmethyl)-2H-triazol-4-yl]ethyl]-1H-imidazol-2-amine;hydrochloride |
| SMILES | Cl.Nc1ncc(CCc2n[nH]nc2Cc2ccco2)[nH]1 |
| InChI | InChI=1S/C12H14N6O.ClH/c13-12-14-7-8(15-12)3-4-10-11(17-18-16-10)6-9-2-1-5-19-9;/h1-2,5,7H,3-4,6H2,(H3,13,14,15)(H,16,17,18);1H |
| InChIKey | XRNSHAIRMMGHBX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |