C25H24N2O4 — CID 67071518
methyl 3-[1'-[(1-methylindol-3-yl)methyl]-4-oxospiro[3H-chromene-2,3'-azetidine]-6-yl]prop-2-enoate (PubChem CID 67071518) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is methyl 3-[1'-[(1-methylindol-3-yl)methyl]-4-oxospiro[3H-chromene-2,3'-azetidine]-6-yl]prop-2-enoate.
| Compound Name | methyl 3-[1'-[(1-methylindol-3-yl)methyl]-4-oxospiro[3H-chromene-2,3'-azetidine]-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67071518 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | methyl 3-[1'-[(1-methylindol-3-yl)methyl]-4-oxospiro[3H-chromene-2,3'-azetidine]-6-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc2c(c1)C(=O)CC1(CN(Cc3cn(C)c4ccccc34)C1)O2 |
| InChI | InChI=1S/C25H24N2O4/c1-26-13-18(19-5-3-4-6-21(19)26)14-27-15-25(16-27)12-22(28)20-11-17(7-9-23(20)31-25)8-10-24(29)30-2/h3-11,13H,12,14-16H2,1-2H3 |
| InChIKey | OZLHQMTZSVZRAQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|