C16H18N4O4S — CID 67077797
methyl (2R)-2-amino-3-[[3-(carbamoylamino)-5-phenylthiophene-2-carbonyl]amino]propanoate (PubChem CID 67077797) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-[[3-(carbamoylamino)-5-phenylthiophene-2-carbonyl]amino]propanoate.
| Compound Name | methyl (2R)-2-amino-3-[[3-(carbamoylamino)-5-phenylthiophene-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 67077797 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | methyl (2R)-2-amino-3-[[3-(carbamoylamino)-5-phenylthiophene-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](N)CNC(=O)c1sc(-c2ccccc2)cc1NC(N)=O |
| InChI | InChI=1S/C16H18N4O4S/c1-24-15(22)10(17)8-19-14(21)13-11(20-16(18)23)7-12(25-13)9-5-3-2-4-6-9/h2-7,10H,8,17H2,1H3,(H,19,21)(H3,18,20,23)/t10-/m1/s1 |
| InChIKey | LYCYAWGQTKKLPN-SNVBAGLBSA-N |
| XLogP | 1.14 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |